C18H18N6OS — CID 985458
1-(4-methylphenyl)-3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]thiourea (PubChem CID 985458) has the molecular formula C18H18N6OS and a molecular weight of 366.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]thiourea.
| Compound Name | 1-(4-methylphenyl)-3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 985458 |
| Molecular Formula | C18H18N6OS |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 1-(4-methylphenyl)-3-[(5-methyl-1-phenyltriazole-4-carbonyl)amino]thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2nnn(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C18H18N6OS/c1-12-8-10-14(11-9-12)19-18(26)22-21-17(25)16-13(2)24(23-20-16)15-6-4-3-5-7-15/h3-11H,1-2H3,(H,21,25)(H2,19,22,26) |
| InChIKey | BJDDYHRVCAUSQV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|