C21H18N6O2 — CID 55881693
N'-[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]quinoline-2-carbohydrazide (PubChem CID 55881693) has the molecular formula C21H18N6O2 and a molecular weight of 386.42 g/mol. Its IUPAC name is N'-[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]quinoline-2-carbohydrazide.
| Compound Name | N'-[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]quinoline-2-carbohydrazide |
|---|---|
| PubChem CID | 55881693 |
| Molecular Formula | C21H18N6O2 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N'-[5-methyl-1-(4-methylphenyl)triazole-4-carbonyl]quinoline-2-carbohydrazide |
| SMILES | Cc1ccc(-n2nnc(C(=O)NNC(=O)c3ccc4ccccc4n3)c2C)cc1 |
| InChI | InChI=1S/C21H18N6O2/c1-13-7-10-16(11-8-13)27-14(2)19(23-26-27)21(29)25-24-20(28)18-12-9-15-5-3-4-6-17(15)22-18/h3-12H,1-2H3,(H,24,28)(H,25,29) |
| InChIKey | FFMULLLEAZGHKE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|