C21H17N5O2 — CID 137375578
1-(2-acetylphenyl)-5-methyl-N-quinolin-2-yltriazole-4-carboxamide (PubChem CID 137375578) has the molecular formula C21H17N5O2 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-(2-acetylphenyl)-5-methyl-N-quinolin-2-yltriazole-4-carboxamide.
| Compound Name | 1-(2-acetylphenyl)-5-methyl-N-quinolin-2-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 137375578 |
| Molecular Formula | C21H17N5O2 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-(2-acetylphenyl)-5-methyl-N-quinolin-2-yltriazole-4-carboxamide |
| SMILES | CC(=O)c1ccccc1-n1nnc(C(=O)Nc2ccc3ccccc3n2)c1C |
| InChI | InChI=1S/C21H17N5O2/c1-13-20(24-25-26(13)18-10-6-4-8-16(18)14(2)27)21(28)23-19-12-11-15-7-3-5-9-17(15)22-19/h3-12H,1-2H3,(H,22,23,28) |
| InChIKey | ASXMTIPUKIOUJH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |