C17H17N3O3 — CID 139232133
(5E)-1,3-dimethyl-5-[(1-propanoylindol-3-yl)methylidene]imidazolidine-2,4-dione (PubChem CID 139232133) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (5E)-1,3-dimethyl-5-[(1-propanoylindol-3-yl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-1,3-dimethyl-5-[(1-propanoylindol-3-yl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 139232133 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (5E)-1,3-dimethyl-5-[(1-propanoylindol-3-yl)methylidene]imidazolidine-2,4-dione |
| SMILES | CCC(=O)n1cc(/C=C2\C(=O)N(C)C(=O)N2C)c2ccccc21 |
| InChI | InChI=1S/C17H17N3O3/c1-4-15(21)20-10-11(12-7-5-6-8-13(12)20)9-14-16(22)19(3)17(23)18(14)2/h5-10H,4H2,1-3H3/b14-9+ |
| InChIKey | ZTWPZKVXBZJBAB-NTEUORMPSA-N |
| XLogP | 2.56 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|