C26H25FeNO2S — CID 139234508
3-(2-aminophenyl)sulfanyl-1-cyclopenta-2,4-dien-1-ylidene-3-(4-methoxyphenyl)propan-1-olate;cyclopenta-1,3-diene;iron(2+) (PubChem CID 139234508) has the molecular formula C26H25FeNO2S and a molecular weight of 471.40 g/mol. Its IUPAC name is 3-(2-aminophenyl)sulfanyl-1-cyclopenta-2,4-dien-1-ylidene-3-(4-methoxyphenyl)propan-1-olate;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 3-(2-aminophenyl)sulfanyl-1-cyclopenta-2,4-dien-1-ylidene-3-(4-methoxyphenyl)propan-1-olate;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 139234508 |
| Molecular Formula | C26H25FeNO2S |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 3-(2-aminophenyl)sulfanyl-1-cyclopenta-2,4-dien-1-ylidene-3-(4-methoxyphenyl)propan-1-olate;cyclopenta-1,3-diene;iron(2+) |
| SMILES | COc1ccc(C(CC([O-])=C2C=CC=C2)Sc2ccccc2N)cc1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C21H21NO2S.C5H5.Fe/c1-24-17-12-10-16(11-13-17)21(14-19(23)15-6-2-3-7-15)25-20-9-5-4-8-18(20)22;1-2-4-5-3-1;/h2-13,21,23H,14,22H2,1H3;1-5H;/q;-1;+2/p-1 |
| InChIKey | LSJURWFZRUVBRY-UHFFFAOYSA-M |
| XLogP | 5.64 |
| TPSA | 58.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|