C27H22ClNO2 — CID 139235708
N-[2-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-methylphenyl]benzamide (PubChem CID 139235708) has the molecular formula C27H22ClNO2 and a molecular weight of 427.93 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-methylphenyl]benzamide.
| Compound Name | N-[2-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-methylphenyl]benzamide |
|---|---|
| PubChem CID | 139235708 |
| Molecular Formula | C27H22ClNO2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | N-[2-(4-chlorophenyl)-5-(4-methoxyphenyl)-4-methylphenyl]benzamide |
| SMILES | COc1ccc(-c2cc(NC(=O)c3ccccc3)c(-c3ccc(Cl)cc3)cc2C)cc1 |
| InChI | InChI=1S/C27H22ClNO2/c1-18-16-25(20-8-12-22(28)13-9-20)26(29-27(30)21-6-4-3-5-7-21)17-24(18)19-10-14-23(31-2)15-11-19/h3-17H,1-2H3,(H,29,30) |
| InChIKey | HYSHNCQRXUUCNS-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |