C25H18ClNO4 — CID 3008802
4-[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]carbamoyl]benzoic acid (PubChem CID 3008802) has the molecular formula C25H18ClNO4 and a molecular weight of 431.88 g/mol. Its IUPAC name is 4-[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]carbamoyl]benzoic acid.
| Compound Name | 4-[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3008802 |
| Molecular Formula | C25H18ClNO4 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | 4-[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)Nc2ccc3c(COc4cccc(Cl)c4)cccc3c2)cc1 |
| InChI | InChI=1S/C25H18ClNO4/c26-20-5-2-6-22(14-20)31-15-19-4-1-3-18-13-21(11-12-23(18)19)27-24(28)16-7-9-17(10-8-16)25(29)30/h1-14H,15H2,(H,27,28)(H,29,30) |
| InChIKey | DADLQQSQNPDMSN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |