C30H26ClNO4 — CID 10413628
3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]-5-(2-methylpropanoylamino)benzoic acid (PubChem CID 10413628) has the molecular formula C30H26ClNO4 and a molecular weight of 499.99 g/mol. Its IUPAC name is 3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]-5-(2-methylpropanoylamino)benzoic acid.
| Compound Name | 3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]-5-(2-methylpropanoylamino)benzoic acid |
|---|---|
| PubChem CID | 10413628 |
| Molecular Formula | C30H26ClNO4 |
| Molecular Weight | 499.99 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 3-[2-(5-chloro-2-phenylmethoxyphenyl)phenyl]-5-(2-methylpropanoylamino)benzoic acid |
| SMILES | CC(C)C(=O)Nc1cc(C(=O)O)cc(-c2ccccc2-c2cc(Cl)ccc2OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H26ClNO4/c1-19(2)29(33)32-24-15-21(14-22(16-24)30(34)35)25-10-6-7-11-26(25)27-17-23(31)12-13-28(27)36-18-20-8-4-3-5-9-20/h3-17,19H,18H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | WIWUOOBNWAOADC-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.99 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |