C25H20ClNO3 — CID 3008806
4-[[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]amino]methyl]benzoic acid (PubChem CID 3008806) has the molecular formula C25H20ClNO3 and a molecular weight of 417.89 g/mol. Its IUPAC name is 4-[[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 3008806 |
| Molecular Formula | C25H20ClNO3 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 4-[[[5-[(3-chlorophenoxy)methyl]naphthalen-2-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNc2ccc3c(COc4cccc(Cl)c4)cccc3c2)cc1 |
| InChI | InChI=1S/C25H20ClNO3/c26-21-5-2-6-23(14-21)30-16-20-4-1-3-19-13-22(11-12-24(19)20)27-15-17-7-9-18(10-8-17)25(28)29/h1-14,27H,15-16H2,(H,28,29) |
| InChIKey | AFXOVFUJPCHPGE-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |