C26H16N4S4 — CID 139236157
2-(5-imidazo[2,1-b][1,3]benzothiazol-2-yl-3,4-dimethylthieno[2,3-b]thiophen-2-yl)imidazo[2,1-b][1,3]benzothiazole (PubChem CID 139236157) has the molecular formula C26H16N4S4 and a molecular weight of 512.71 g/mol. Its IUPAC name is 2-(5-imidazo[2,1-b][1,3]benzothiazol-2-yl-3,4-dimethylthieno[2,3-b]thiophen-2-yl)imidazo[2,1-b][1,3]benzothiazole.
| Compound Name | 2-(5-imidazo[2,1-b][1,3]benzothiazol-2-yl-3,4-dimethylthieno[2,3-b]thiophen-2-yl)imidazo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 139236157 |
| Molecular Formula | C26H16N4S4 |
| Molecular Weight | 512.71 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 2-(5-imidazo[2,1-b][1,3]benzothiazol-2-yl-3,4-dimethylthieno[2,3-b]thiophen-2-yl)imidazo[2,1-b][1,3]benzothiazole |
| SMILES | Cc1c(-c2cn3c(n2)sc2ccccc23)sc2sc(-c3cn4c(n3)sc3ccccc34)c(C)c12 |
| InChI | InChI=1S/C26H16N4S4/c1-13-21-14(2)23(16-12-30-18-8-4-6-10-20(18)32-26(30)28-16)34-24(21)33-22(13)15-11-29-17-7-3-5-9-19(17)31-25(29)27-15/h3-12H,1-2H3 |
| InChIKey | DTAJZTHKFGZCQO-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.71 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |