C18H20N2O4S — CID 139237224
methyl (2Z)-2-[2-(2,2-dimethylpropanoylimino)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 139237224) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is methyl (2Z)-2-[2-(2,2-dimethylpropanoylimino)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[2-(2,2-dimethylpropanoylimino)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 139237224 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | methyl (2Z)-2-[2-(2,2-dimethylpropanoylimino)-3-(2-methylphenyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\S/C(=N\C(=O)C(C)(C)C)N(c2ccccc2C)C1=O |
| InChI | InChI=1S/C18H20N2O4S/c1-11-8-6-7-9-12(11)20-15(22)13(10-14(21)24-5)25-17(20)19-16(23)18(2,3)4/h6-10H,1-5H3/b13-10-,19-17- |
| InChIKey | ILGUPNZTUGNPPW-FBAIOFKCSA-N |
| XLogP | 3.06 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|