C23H14Cl2N2O4S — CID 142727545
methyl (2Z)-2-[3-(2,6-dichlorophenyl)-2-(naphthalene-2-carbonylimino)-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 142727545) has the molecular formula C23H14Cl2N2O4S and a molecular weight of 485.35 g/mol. Its IUPAC name is methyl (2Z)-2-[3-(2,6-dichlorophenyl)-2-(naphthalene-2-carbonylimino)-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[3-(2,6-dichlorophenyl)-2-(naphthalene-2-carbonylimino)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 142727545 |
| Molecular Formula | C23H14Cl2N2O4S |
| Molecular Weight | 485.35 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | methyl (2Z)-2-[3-(2,6-dichlorophenyl)-2-(naphthalene-2-carbonylimino)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\S/C(=N\C(=O)c2ccc3ccccc3c2)N(c2c(Cl)cccc2Cl)C1=O |
| InChI | InChI=1S/C23H14Cl2N2O4S/c1-31-19(28)12-18-22(30)27(20-16(24)7-4-8-17(20)25)23(32-18)26-21(29)15-10-9-13-5-2-3-6-14(13)11-15/h2-12H,1H3/b18-12-,26-23- |
| InChIKey | XZXZDPPFUCUWRO-MNULPCLDSA-N |
| XLogP | 5.48 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.35 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|