C16H12Cl2N2O4S — CID 139669869
methyl 2-[3-cyclopropyl-2-(2,4-dichlorobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 139669869) has the molecular formula C16H12Cl2N2O4S and a molecular weight of 399.26 g/mol. Its IUPAC name is methyl 2-[3-cyclopropyl-2-(2,4-dichlorobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl 2-[3-cyclopropyl-2-(2,4-dichlorobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 139669869 |
| Molecular Formula | C16H12Cl2N2O4S |
| Molecular Weight | 399.26 g/mol |
| Exact Mass | 397.99 |
| IUPAC Name | methyl 2-[3-cyclopropyl-2-(2,4-dichlorobenzoyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)C=C1S/C(=N\C(=O)c2ccc(Cl)cc2Cl)N(C2CC2)C1=O |
| InChI | InChI=1S/C16H12Cl2N2O4S/c1-24-13(21)7-12-15(23)20(9-3-4-9)16(25-12)19-14(22)10-5-2-8(17)6-11(10)18/h2,5-7,9H,3-4H2,1H3/b12-7?,19-16- |
| InChIKey | KTVJRTCEPSVYPX-XKBJKALASA-N |
| XLogP | 3.28 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.26 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|