C17H18ClFN2O3S — CID 5136846
methyl 2-[2-(3-chloro-4-fluorophenyl)imino-3-(3-methylbutyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 5136846) has the molecular formula C17H18ClFN2O3S and a molecular weight of 384.86 g/mol. Its IUPAC name is methyl 2-[2-(3-chloro-4-fluorophenyl)imino-3-(3-methylbutyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl 2-[2-(3-chloro-4-fluorophenyl)imino-3-(3-methylbutyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 5136846 |
| Molecular Formula | C17H18ClFN2O3S |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | methyl 2-[2-(3-chloro-4-fluorophenyl)imino-3-(3-methylbutyl)-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)C=C1S/C(=N\c2ccc(F)c(Cl)c2)N(CCC(C)C)C1=O |
| InChI | InChI=1S/C17H18ClFN2O3S/c1-10(2)6-7-21-16(23)14(9-15(22)24-3)25-17(21)20-11-4-5-13(19)12(18)8-11/h4-5,8-10H,6-7H2,1-3H3/b14-9?,20-17- |
| InChIKey | VMCVVLKBGJWHHX-XRRFOWBKSA-N |
| XLogP | 4.14 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|