C20H16ClFN2O4S — CID 6536353
methyl (2Z)-2-[2-(3-chloro-4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 6536353) has the molecular formula C20H16ClFN2O4S and a molecular weight of 434.88 g/mol. Its IUPAC name is methyl (2Z)-2-[2-(3-chloro-4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2Z)-2-[2-(3-chloro-4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 6536353 |
| Molecular Formula | C20H16ClFN2O4S |
| Molecular Weight | 434.88 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | methyl (2Z)-2-[2-(3-chloro-4-fluorophenyl)imino-3-[(4-methoxyphenyl)methyl]-4-oxo-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\S/C(=N\c2ccc(F)c(Cl)c2)N(Cc2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C20H16ClFN2O4S/c1-27-14-6-3-12(4-7-14)11-24-19(26)17(10-18(25)28-2)29-20(24)23-13-5-8-16(22)15(21)9-13/h3-10H,11H2,1-2H3/b17-10-,23-20- |
| InChIKey | QKXOPCJFTDMMAN-PLISCHTNSA-N |
| XLogP | 4.31 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.88 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|