C26H21F2N3O3S — CID 4038079
2-[3-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylimino]-4-oxo-1,3-thiazolidin-5-ylidene]-N-(4-methoxyphenyl)acetamide (PubChem CID 4038079) has the molecular formula C26H21F2N3O3S and a molecular weight of 493.54 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylimino]-4-oxo-1,3-thiazolidin-5-ylidene]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylimino]-4-oxo-1,3-thiazolidin-5-ylidene]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 4038079 |
| Molecular Formula | C26H21F2N3O3S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-2-[(4-fluorophenyl)methylimino]-4-oxo-1,3-thiazolidin-5-ylidene]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)C=C2S/C(=N\Cc3ccc(F)cc3)N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H21F2N3O3S/c1-34-22-12-10-21(11-13-22)30-24(32)14-23-25(33)31(16-18-4-8-20(28)9-5-18)26(35-23)29-15-17-2-6-19(27)7-3-17/h2-14H,15-16H2,1H3,(H,30,32)/b23-14?,29-26- |
| InChIKey | PGDBTIBLJGUDCE-OIGNSQSESA-N |
| XLogP | 5.13 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|