C23H18ClN5O2S — CID 17118377
(2Z)-N-(3-chlorophenyl)-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-ylidene]acetamide (PubChem CID 17118377) has the molecular formula C23H18ClN5O2S and a molecular weight of 463.95 g/mol. Its IUPAC name is (2Z)-N-(3-chlorophenyl)-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-ylidene]acetamide.
| Compound Name | (2Z)-N-(3-chlorophenyl)-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-ylidene]acetamide |
|---|---|
| PubChem CID | 17118377 |
| Molecular Formula | C23H18ClN5O2S |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | (2Z)-N-(3-chlorophenyl)-2-[4-oxo-3-(pyridin-3-ylmethyl)-2-(pyridin-3-ylmethylimino)-1,3-thiazolidin-5-ylidene]acetamide |
| SMILES | O=C(/C=C1\S/C(=N\Cc2cccnc2)N(Cc2cccnc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H18ClN5O2S/c24-18-6-1-7-19(10-18)28-21(30)11-20-22(31)29(15-17-5-3-9-26-13-17)23(32-20)27-14-16-4-2-8-25-12-16/h1-13H,14-15H2,(H,28,30)/b20-11-,27-23- |
| InChIKey | XAABZXDGWUVDFT-PQHUPVKOSA-N |
| XLogP | 4.28 |
| TPSA | 87.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|