C27H24ClN3O2S — CID 5042171
N-(3-chlorophenyl)-2-[4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazolidin-5-ylidene]acetamide (PubChem CID 5042171) has the molecular formula C27H24ClN3O2S and a molecular weight of 490.03 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazolidin-5-ylidene]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazolidin-5-ylidene]acetamide |
|---|---|
| PubChem CID | 5042171 |
| Molecular Formula | C27H24ClN3O2S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N-(3-chlorophenyl)-2-[4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazolidin-5-ylidene]acetamide |
| SMILES | O=C(C=C1S/C(=N\CCc2ccccc2)N(CCc2ccccc2)C1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H24ClN3O2S/c28-22-12-7-13-23(18-22)30-25(32)19-24-26(33)31(17-15-21-10-5-2-6-11-21)27(34-24)29-16-14-20-8-3-1-4-9-20/h1-13,18-19H,14-17H2,(H,30,32)/b24-19?,29-27- |
| InChIKey | WJVRKYROXYQSER-KUAXBDNCSA-N |
| XLogP | 5.58 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|