C28H27N3O4S — CID 40844734
4-[[(6R)-4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazinane-6-carbonyl]amino]benzoic acid (PubChem CID 40844734) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is 4-[[(6R)-4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazinane-6-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[(6R)-4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 40844734 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | 4-[[(6R)-4-oxo-3-(2-phenylethyl)-2-(2-phenylethylimino)-1,3-thiazinane-6-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H]2CC(=O)N(CCc3ccccc3)/C(=N/CCc3ccccc3)S2)cc1 |
| InChI | InChI=1S/C28H27N3O4S/c32-25-19-24(26(33)30-23-13-11-22(12-14-23)27(34)35)36-28(29-17-15-20-7-3-1-4-8-20)31(25)18-16-21-9-5-2-6-10-21/h1-14,24H,15-19H2,(H,30,33)(H,34,35)/b29-28-/t24-/m1/s1 |
| InChIKey | SYJVPZFXWQSJCT-CFZMGFRKSA-N |
| XLogP | 4.50 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|