C17H12ClFN2O3S2 — CID 7318422
methyl (2E)-2-[2-(3-chloro-4-fluorophenyl)imino-4-oxo-3-(thiophen-2-ylmethyl)-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 7318422) has the molecular formula C17H12ClFN2O3S2 and a molecular weight of 410.88 g/mol. Its IUPAC name is methyl (2E)-2-[2-(3-chloro-4-fluorophenyl)imino-4-oxo-3-(thiophen-2-ylmethyl)-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[2-(3-chloro-4-fluorophenyl)imino-4-oxo-3-(thiophen-2-ylmethyl)-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 7318422 |
| Molecular Formula | C17H12ClFN2O3S2 |
| Molecular Weight | 410.88 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | methyl (2E)-2-[2-(3-chloro-4-fluorophenyl)imino-4-oxo-3-(thiophen-2-ylmethyl)-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1/S/C(=N\c2ccc(F)c(Cl)c2)N(Cc2cccs2)C1=O |
| InChI | InChI=1S/C17H12ClFN2O3S2/c1-24-15(22)8-14-16(23)21(9-11-3-2-6-25-11)17(26-14)20-10-4-5-13(19)12(18)7-10/h2-8H,9H2,1H3/b14-8+,20-17- |
| InChIKey | ZIWKOJQWCGTETP-GUVYHVJLSA-N |
| XLogP | 4.36 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|