C17H18N2O5S — CID 4002292
methyl 4-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoate (PubChem CID 4002292) has the molecular formula C17H18N2O5S and a molecular weight of 362.41 g/mol. Its IUPAC name is methyl 4-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoate.
| Compound Name | methyl 4-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoate |
|---|---|
| PubChem CID | 4002292 |
| Molecular Formula | C17H18N2O5S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 4-[[5-(2-methoxy-2-oxoethylidene)-4-oxo-3-propan-2-yl-1,3-thiazolidin-2-ylidene]amino]benzoate |
| SMILES | COC(=O)C=C1S/C(=N\c2ccc(C(=O)OC)cc2)N(C(C)C)C1=O |
| InChI | InChI=1S/C17H18N2O5S/c1-10(2)19-15(21)13(9-14(20)23-3)25-17(19)18-12-7-5-11(6-8-12)16(22)24-4/h5-10H,1-4H3/b13-9?,18-17- |
| InChIKey | BAAMETQLFQMZTH-NNVVTTAXSA-N |
| XLogP | 2.50 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|