C22H20Cl2N4O4S — CID 139669948
methyl 2-[3-[4-(2-aminoethylcarbamoyl)phenyl]-2-(2,4-dichlorobenzoyl)imino-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 139669948) has the molecular formula C22H20Cl2N4O4S and a molecular weight of 507.40 g/mol. Its IUPAC name is methyl 2-[3-[4-(2-aminoethylcarbamoyl)phenyl]-2-(2,4-dichlorobenzoyl)imino-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | methyl 2-[3-[4-(2-aminoethylcarbamoyl)phenyl]-2-(2,4-dichlorobenzoyl)imino-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 139669948 |
| Molecular Formula | C22H20Cl2N4O4S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | methyl 2-[3-[4-(2-aminoethylcarbamoyl)phenyl]-2-(2,4-dichlorobenzoyl)imino-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | COC(=O)C=C1CN(c2ccc(C(=O)NCCN)cc2)/C(=N/C(=O)c2ccc(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C22H20Cl2N4O4S/c1-32-19(29)11-16-12-28(15-5-2-13(3-6-15)20(30)26-9-8-25)22(33-16)27-21(31)17-7-4-14(23)10-18(17)24/h2-7,10-11H,8-9,12,25H2,1H3,(H,26,30)/b16-11?,27-22- |
| InChIKey | GSYBIBLOCNIHNR-UVMNFOOYSA-N |
| XLogP | 3.49 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|