C20H16ClN3O4S — CID 139670008
2-aminoethyl 2-[2-(2-chlorobenzoyl)imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate (PubChem CID 139670008) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 2-aminoethyl 2-[2-(2-chlorobenzoyl)imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate.
| Compound Name | 2-aminoethyl 2-[2-(2-chlorobenzoyl)imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate |
|---|---|
| PubChem CID | 139670008 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-aminoethyl 2-[2-(2-chlorobenzoyl)imino-4-oxo-3-phenyl-1,3-thiazolidin-5-ylidene]acetate |
| SMILES | NCCOC(=O)C=C1S/C(=N\C(=O)c2ccccc2Cl)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H16ClN3O4S/c21-15-9-5-4-8-14(15)18(26)23-20-24(13-6-2-1-3-7-13)19(27)16(29-20)12-17(25)28-11-10-22/h1-9,12H,10-11,22H2/b16-12?,23-20- |
| InChIKey | DBUGRRVGBSLVFI-GUMUUMMYSA-N |
| XLogP | 3.00 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|