C27H17ClN2O2S — CID 139669989
2-chloro-N-[5-(naphthalen-2-ylmethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]benzamide (PubChem CID 139669989) has the molecular formula C27H17ClN2O2S and a molecular weight of 468.97 g/mol. Its IUPAC name is 2-chloro-N-[5-(naphthalen-2-ylmethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]benzamide.
| Compound Name | 2-chloro-N-[5-(naphthalen-2-ylmethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 139669989 |
| Molecular Formula | C27H17ClN2O2S |
| Molecular Weight | 468.97 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-chloro-N-[5-(naphthalen-2-ylmethylidene)-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]benzamide |
| SMILES | O=C(/N=C1\SC(=Cc2ccc3ccccc3c2)C(=O)N1c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C27H17ClN2O2S/c28-23-13-7-6-12-22(23)25(31)29-27-30(21-10-2-1-3-11-21)26(32)24(33-27)17-18-14-15-19-8-4-5-9-20(19)16-18/h1-17H/b24-17?,29-27- |
| InChIKey | SFZHSOXMGXWSMZ-DMTGGRBTSA-N |
| XLogP | 6.81 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.97 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|