C26H20Cl2N2O — CID 139237578
20-(3,4-dichlorophenyl)-9-ethyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(13),2(10),3,5,7,11,15(19)-heptaen-18-one (PubChem CID 139237578) has the molecular formula C26H20Cl2N2O and a molecular weight of 447.37 g/mol. Its IUPAC name is 20-(3,4-dichlorophenyl)-9-ethyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(13),2(10),3,5,7,11,15(19)-heptaen-18-one.
| Compound Name | 20-(3,4-dichlorophenyl)-9-ethyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(13),2(10),3,5,7,11,15(19)-heptaen-18-one |
|---|---|
| PubChem CID | 139237578 |
| Molecular Formula | C26H20Cl2N2O |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 20-(3,4-dichlorophenyl)-9-ethyl-9,14-diazapentacyclo[11.7.0.02,10.03,8.015,19]icosa-1(13),2(10),3,5,7,11,15(19)-heptaen-18-one |
| SMILES | CCn1c2ccccc2c2c3c(ccc21)NC1=C(C(=O)CC1)C3c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H20Cl2N2O/c1-2-30-20-6-4-3-5-15(20)24-21(30)11-9-19-26(24)23(14-7-8-16(27)17(28)13-14)25-18(29-19)10-12-22(25)31/h3-9,11,13,23,29H,2,10,12H2,1H3 |
| InChIKey | IWQXTGNCEPLZAG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |