C29H27FN2O — CID 139222581
10-ethyl-14-(4-fluorophenyl)-18,18-dimethyl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20)-heptaen-16-one (PubChem CID 139222581) has the molecular formula C29H27FN2O and a molecular weight of 438.55 g/mol. Its IUPAC name is 10-ethyl-14-(4-fluorophenyl)-18,18-dimethyl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20)-heptaen-16-one.
| Compound Name | 10-ethyl-14-(4-fluorophenyl)-18,18-dimethyl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20)-heptaen-16-one |
|---|---|
| PubChem CID | 139222581 |
| Molecular Formula | C29H27FN2O |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 10-ethyl-14-(4-fluorophenyl)-18,18-dimethyl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15(20)-heptaen-16-one |
| SMILES | CCn1c2ccccc2c2cc3c(cc21)C(c1ccc(F)cc1)C1=C(CC(C)(C)CC1=O)N3 |
| InChI | InChI=1S/C29H27FN2O/c1-4-32-24-8-6-5-7-19(24)20-13-22-21(14-25(20)32)27(17-9-11-18(30)12-10-17)28-23(31-22)15-29(2,3)16-26(28)33/h5-14,27,31H,4,15-16H2,1-3H3 |
| InChIKey | ZNBIXTXOZBSYPA-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |