C21H26N2O4S — CID 139238976
CID 139238976 (PubChem CID 139238976) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol.
| Compound Name | CID 139238976 |
|---|---|
| PubChem CID | 139238976 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)[C@H](CCSC)NC(=O)C1=C[CH][CH]C1 |
| InChI | InChI=1S/C21H26N2O4S/c1-27-21(26)18(14-15-8-4-3-5-9-15)23-20(25)17(12-13-28-2)22-19(24)16-10-6-7-11-16/h3-10,17-18H,11-14H2,1-2H3,(H,22,24)(H,23,25)/t17-,18-/m0/s1 |
| InChIKey | RULJDFHXVCBKCK-ROUUACIJSA-N |
| XLogP | 1.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |