About nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine
nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine (PubChem CID 139240662) has the molecular formula C26H22N2NiO2
and a molecular weight of 453.17 g/mol. Its IUPAC name is nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine |
| PubChem CID | 139240662 |
| Molecular Formula | C26H22N2NiO2 |
| Molecular Weight | 453.17 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine |
| SMILES | CC(=O)c1cc[c-]cc1.CC(=O)c1cc[c-]cc1.[Ni+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2C8H7O.Ni/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-7(9)8-5-3-2-4-6-8;/h1-8H;2*3-6H,1H3;/q;2*-1;+2 |
| InChIKey | WLIKYBSVBGRUEU-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.17 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine?
The IUPAC name of nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine (CID 139240662) is nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine.
What is the SMILES notation for nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine?
The canonical SMILES for nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine is CC(=O)c1cc[c-]cc1.CC(=O)c1cc[c-]cc1.[Ni+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine?
The InChIKey is WLIKYBSVBGRUEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C8H7O.Ni/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;2*1-7(9)8-5-3-2-4-6-8;/h1-8H;2*3-6H,1H3;/q;2*-1;+2.
What are the key properties of nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine?
nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine has a molecular weight of 453.17 g/mol, XLogP of 5.52, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel(2+);bis(1-phenylethanone);2-pyridin-2-ylpyridine is sourced from PubChem (CID 139240662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).