C29H34Cl2CuN6O — CID 139241227
N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichlorocopper;N,N-dimethylformamide (PubChem CID 139241227) has the molecular formula C29H34Cl2CuN6O and a molecular weight of 617.08 g/mol. Its IUPAC name is N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichlorocopper;N,N-dimethylformamide.
| Compound Name | N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichlorocopper;N,N-dimethylformamide |
|---|---|
| PubChem CID | 139241227 |
| Molecular Formula | C29H34Cl2CuN6O |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichlorocopper;N,N-dimethylformamide |
| SMILES | CCn1c(CN(Cc2nc3ccccc3n2CC)c2ccccc2)nc2ccccc21.CN(C)C=O.Cl[Cu]Cl |
| InChI | InChI=1S/C26H27N5.C3H7NO.2ClH.Cu/c1-3-30-23-16-10-8-14-21(23)27-25(30)18-29(20-12-6-5-7-13-20)19-26-28-22-15-9-11-17-24(22)31(26)4-2;1-4(2)3-5;;;/h5-17H,3-4,18-19H2,1-2H3;3H,1-2H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | QIPLBWLDKFBXJB-UHFFFAOYSA-L |
| XLogP | 6.71 |
| TPSA | 59.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|