C26H27Cl2N5Ni — CID 139241229
N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichloronickel (PubChem CID 139241229) has the molecular formula C26H27Cl2N5Ni and a molecular weight of 539.14 g/mol. Its IUPAC name is N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichloronickel.
| Compound Name | N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichloronickel |
|---|---|
| PubChem CID | 139241229 |
| Molecular Formula | C26H27Cl2N5Ni |
| Molecular Weight | 539.14 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | N,N-bis[(1-ethylbenzimidazol-2-yl)methyl]aniline;dichloronickel |
| SMILES | CCn1c(CN(Cc2nc3ccccc3n2CC)c2ccccc2)nc2ccccc21.Cl[Ni]Cl |
| InChI | InChI=1S/C26H27N5.2ClH.Ni/c1-3-30-23-16-10-8-14-21(23)27-25(30)18-29(20-12-6-5-7-13-20)19-26-28-22-15-9-11-17-24(22)31(26)4-2;;;/h5-17H,3-4,18-19H2,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | LROZISMNLMPVBM-UHFFFAOYSA-L |
| XLogP | 7.01 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.14 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |