C36H26N8O4Zn — CID 139241786
zinc bis(N-[(E)-1-(benzimidazol-1-id-2-yl)ethylideneamino]-1-benzofuran-2-carboxamide) (PubChem CID 139241786) has the molecular formula C36H26N8O4Zn and a molecular weight of 700.05 g/mol. Its IUPAC name is zinc bis(N-[(E)-1-(benzimidazol-1-id-2-yl)ethylideneamino]-1-benzofuran-2-carboxamide).
| Compound Name | zinc bis(N-[(E)-1-(benzimidazol-1-id-2-yl)ethylideneamino]-1-benzofuran-2-carboxamide) |
|---|---|
| PubChem CID | 139241786 |
| Molecular Formula | C36H26N8O4Zn |
| Molecular Weight | 700.05 g/mol |
| Exact Mass | 698.14 |
| IUPAC Name | zinc bis(N-[(E)-1-(benzimidazol-1-id-2-yl)ethylideneamino]-1-benzofuran-2-carboxamide) |
| SMILES | C/C(=N\NC(=O)c1cc2ccccc2o1)c1nc2ccccc2[n-]1.C/C(=N\NC(=O)c1cc2ccccc2o1)c1nc2ccccc2[n-]1.[Zn+2] |
| InChI | InChI=1S/2C18H14N4O2.Zn/c2*1-11(17-19-13-7-3-4-8-14(13)20-17)21-22-18(23)16-10-12-6-2-5-9-15(12)24-16;/h2*2-10H,1H3,(H2,19,20,21,22,23);/q;;+2/p-2 |
| InChIKey | VSDWKUIQZQHTPL-UHFFFAOYSA-L |
| XLogP | 6.18 |
| TPSA | 163.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.05 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|