C29H33NO3Sn — CID 139242363
triphenylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate (PubChem CID 139242363) has the molecular formula C29H33NO3Sn and a molecular weight of 562.30 g/mol. Its IUPAC name is triphenylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate.
| Compound Name | triphenylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate |
|---|---|
| PubChem CID | 139242363 |
| Molecular Formula | C29H33NO3Sn |
| Molecular Weight | 562.30 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | triphenylstannyl (2S)-4-methyl-2-[[(Z)-4-oxopent-2-en-2-yl]amino]pentanoate |
| SMILES | CC(=O)/C=C(/C)N[C@@H](CC(C)C)C(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C11H19NO3.3C6H5.Sn/c1-7(2)5-10(11(14)15)12-8(3)6-9(4)13;3*1-2-4-6-5-3-1;/h6-7,10,12H,5H2,1-4H3,(H,14,15);3*1-5H;/q;;;;+1/p-1/b8-6-;;;;/t10-;;;;/m0..../s1 |
| InChIKey | HKSNOTSCKHFSAF-OKZOOCEQSA-M |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|