C8H10ClN3O2 — CID 139242895
[(1S,4R)-4-azido-3-chlorocyclohex-2-en-1-yl] acetate (PubChem CID 139242895) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is [(1S,4R)-4-azido-3-chlorocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4R)-4-azido-3-chlorocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 139242895 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | [(1S,4R)-4-azido-3-chlorocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=C(Cl)[C@H](N=[N+]=[N-])CC1 |
| InChI | InChI=1S/C8H10ClN3O2/c1-5(13)14-6-2-3-8(11-12-10)7(9)4-6/h4,6,8H,2-3H2,1H3/t6-,8+/m0/s1 |
| InChIKey | KJXDLXQPUUQSJK-POYBYMJQSA-N |
| XLogP | 2.51 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|