About [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate
[(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate (PubChem CID 139242892) has the molecular formula C8H10ClN3O2
and a molecular weight of 215.64 g/mol. Its IUPAC name is [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate.
Molecular Properties
| Compound Name | [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate |
| PubChem CID | 139242892 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC=C(Cl)[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H10ClN3O2/c1-5(13)14-7-4-2-3-6(9)8(7)11-12-10/h3,7-8H,2,4H2,1H3/t7-,8+/m1/s1 |
| InChIKey | FFCLZXUXKAHMGT-SFYZADRCSA-N |
| XLogP | 2.51 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate?
The IUPAC name of [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate (CID 139242892) is [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate.
What is the SMILES notation for [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate?
The canonical SMILES for [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate is CC(=O)O[C@@H]1CCC=C(Cl)[C@@H]1N=[N+]=[N-].
What is the InChIKey of [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate?
The InChIKey is FFCLZXUXKAHMGT-SFYZADRCSA-N. The full InChI is InChI=1S/C8H10ClN3O2/c1-5(13)14-7-4-2-3-6(9)8(7)11-12-10/h3,7-8H,2,4H2,1H3/t7-,8+/m1/s1.
What are the key properties of [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate?
[(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate has a molecular weight of 215.64 g/mol, XLogP of 2.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-azido-3-chlorocyclohex-3-en-1-yl] acetate is sourced from PubChem (CID 139242892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).