C8H11N3O2 — CID 130762374
[(1R,2R)-2-azidocyclohex-3-en-1-yl] acetate (PubChem CID 130762374) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is [(1R,2R)-2-azidocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2R)-2-azidocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 130762374 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | [(1R,2R)-2-azidocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC=C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H11N3O2/c1-6(12)13-8-5-3-2-4-7(8)10-11-9/h2,4,7-8H,3,5H2,1H3/t7-,8-/m1/s1 |
| InChIKey | SNCJQXRTIVHFRW-HTQZYQBOSA-N |
| XLogP | 1.95 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|