C10H12N6O4 — CID 10967900
[(1R,2S,5S,6R)-6-acetyloxy-2,5-diazidocyclohex-3-en-1-yl] acetate (PubChem CID 10967900) has the molecular formula C10H12N6O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is [(1R,2S,5S,6R)-6-acetyloxy-2,5-diazidocyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R,2S,5S,6R)-6-acetyloxy-2,5-diazidocyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10967900 |
| Molecular Formula | C10H12N6O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [(1R,2S,5S,6R)-6-acetyloxy-2,5-diazidocyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](N=[N+]=[N-])C=C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C10H12N6O4/c1-5(17)19-9-7(13-15-11)3-4-8(14-16-12)10(9)20-6(2)18/h3-4,7-10H,1-2H3/t7-,8-,9+,10+/m0/s1 |
| InChIKey | GKZNRMWTTYSYBH-AXTSPUMRSA-N |
| XLogP | 1.78 |
| TPSA | 150.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|