C16H30N2O4+2 — CID 3071593
[(1S,4R,5R,6R)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium (PubChem CID 3071593) has the molecular formula C16H30N2O4+2 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(1S,4R,5R,6R)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium.
| Compound Name | [(1S,4R,5R,6R)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium |
|---|---|
| PubChem CID | 3071593 |
| Molecular Formula | C16H30N2O4+2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | [(1S,4R,5R,6R)-5,6-diacetyloxy-4-(trimethylazaniumyl)cyclohex-2-en-1-yl]-trimethylazanium |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H]([N+](C)(C)C)C=C[C@H]1[N+](C)(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-11(19)21-15-13(17(3,4)5)9-10-14(18(6,7)8)16(15)22-12(2)20/h9-10,13-16H,1-8H3/q+2/t13-,14+,15-,16-/m1/s1 |
| InChIKey | UJKRZTYIIYIZMN-QKPAOTATSA-N |
| XLogP | 0.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|