C8H11N3O3 — CID 14447114
[(2S,3R,4S)-4-azido-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate (PubChem CID 14447114) has the molecular formula C8H11N3O3 and a molecular weight of 197.19 g/mol. Its IUPAC name is [(2S,3R,4S)-4-azido-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2S,3R,4S)-4-azido-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 14447114 |
| Molecular Formula | C8H11N3O3 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | [(2S,3R,4S)-4-azido-2-methyl-3,4-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](N=[N+]=[N-])C=CO[C@H]1C |
| InChI | InChI=1S/C8H11N3O3/c1-5-8(14-6(2)12)7(10-11-9)3-4-13-5/h3-5,7-8H,1-2H3/t5-,7-,8-/m0/s1 |
| InChIKey | QBTMAHFTNMULDZ-GEVIPFJHSA-N |
| XLogP | 1.53 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|