C12H15N3O6 — CID 11472013
[(1S,4S,5R,6R)-5,6-diacetyloxy-4-azidocyclohex-2-en-1-yl] acetate (PubChem CID 11472013) has the molecular formula C12H15N3O6 and a molecular weight of 297.27 g/mol. Its IUPAC name is [(1S,4S,5R,6R)-5,6-diacetyloxy-4-azidocyclohex-2-en-1-yl] acetate.
| Compound Name | [(1S,4S,5R,6R)-5,6-diacetyloxy-4-azidocyclohex-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 11472013 |
| Molecular Formula | C12H15N3O6 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(1S,4S,5R,6R)-5,6-diacetyloxy-4-azidocyclohex-2-en-1-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)C=C[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O6/c1-6(16)19-10-5-4-9(14-15-13)11(20-7(2)17)12(10)21-8(3)18/h4-5,9-12H,1-3H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | QKXGKBIZDLKXOX-NNYUYHANSA-N |
| XLogP | 1.03 |
| TPSA | 127.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|