C10H15N3O4 — CID 134964212
[(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] acetate (PubChem CID 134964212) has the molecular formula C10H15N3O4 and a molecular weight of 241.25 g/mol. Its IUPAC name is [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 134964212 |
| Molecular Formula | C10H15N3O4 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] acetate |
| SMILES | COCO[C@H]1C=CC[C@@H](N=[N+]=[N-])[C@@H]1OC(C)=O |
| InChI | InChI=1S/C10H15N3O4/c1-7(14)17-10-8(12-13-11)4-3-5-9(10)16-6-15-2/h3,5,8-10H,4,6H2,1-2H3/t8-,9+,10+/m1/s1 |
| InChIKey | VNPHYGZONSJKLO-UTLUCORTSA-N |
| XLogP | 1.55 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|