C9H13N3O4 — CID 86709011
[(2S,3S,6S)-3-azido-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 86709011) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is [(2S,3S,6S)-3-azido-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2S,3S,6S)-3-azido-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 86709011 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | [(2S,3S,6S)-3-azido-6-methoxy-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | CO[C@@H]1C=C[C@H](N=[N+]=[N-])[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C9H13N3O4/c1-6(13)15-5-8-7(11-12-10)3-4-9(14-2)16-8/h3-4,7-9H,5H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | OUSCIFPSIUIDDJ-YIZRAAEISA-N |
| XLogP | 1.16 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|