C28H37F3N2O — CID 139243638
1,2,2,3-tetramethyl-6-(1,2,2,3-tetramethyl-3,4-dihydroquinolin-4-yl)-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline (PubChem CID 139243638) has the molecular formula C28H37F3N2O and a molecular weight of 474.61 g/mol. Its IUPAC name is 1,2,2,3-tetramethyl-6-(1,2,2,3-tetramethyl-3,4-dihydroquinolin-4-yl)-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline.
| Compound Name | 1,2,2,3-tetramethyl-6-(1,2,2,3-tetramethyl-3,4-dihydroquinolin-4-yl)-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 139243638 |
| Molecular Formula | C28H37F3N2O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 1,2,2,3-tetramethyl-6-(1,2,2,3-tetramethyl-3,4-dihydroquinolin-4-yl)-4-(2,2,2-trifluoroethoxy)-3,4-dihydroquinoline |
| SMILES | CC1C(OCC(F)(F)F)c2cc(C3c4ccccc4N(C)C(C)(C)C3C)ccc2N(C)C1(C)C |
| InChI | InChI=1S/C28H37F3N2O/c1-17-24(20-11-9-10-12-22(20)32(7)26(17,3)4)19-13-14-23-21(15-19)25(34-16-28(29,30)31)18(2)27(5,6)33(23)8/h9-15,17-18,24-25H,16H2,1-8H3 |
| InChIKey | JFXAOWDDFWSJIK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |