C34H23N3O2 — CID 139244474
3,10,15-triphenyl-13,15,17-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-2,4,6,8,10,18-hexaene-14,16-dione (PubChem CID 139244474) has the molecular formula C34H23N3O2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 3,10,15-triphenyl-13,15,17-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-2,4,6,8,10,18-hexaene-14,16-dione.
| Compound Name | 3,10,15-triphenyl-13,15,17-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-2,4,6,8,10,18-hexaene-14,16-dione |
|---|---|
| PubChem CID | 139244474 |
| Molecular Formula | C34H23N3O2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | 3,10,15-triphenyl-13,15,17-triazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-2,4,6,8,10,18-hexaene-14,16-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1C=CC2c2c1c(-c1ccccc1)c1ccccc1c2-c1ccccc1 |
| InChI | InChI=1S/C34H23N3O2/c38-33-35(24-16-8-3-9-17-24)34(39)37-28-21-20-27(36(33)37)31-29(22-12-4-1-5-13-22)25-18-10-11-19-26(25)30(32(28)31)23-14-6-2-7-15-23/h1-21,27-28H |
| InChIKey | PGWAOFVBIWWXQR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|