C22H14ClN3O2 — CID 139242462
1-chloro-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 139242462) has the molecular formula C22H14ClN3O2 and a molecular weight of 387.83 g/mol. Its IUPAC name is 1-chloro-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-chloro-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 139242462 |
| Molecular Formula | C22H14ClN3O2 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-chloro-17-phenyl-15,17,19-triazapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=c1n(-c2ccccc2)c(=O)n2n1C1c3ccccc3C2(Cl)c2ccccc21 |
| InChI | InChI=1S/C22H14ClN3O2/c23-22-17-12-6-4-10-15(17)19(16-11-5-7-13-18(16)22)25-20(27)24(21(28)26(22)25)14-8-2-1-3-9-14/h1-13,19H |
| InChIKey | BUIZLHMLGILADK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|