C11H15BBr2N2O2 — CID 139244986
3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 139244986) has the molecular formula C11H15BBr2N2O2 and a molecular weight of 377.87 g/mol. Its IUPAC name is 3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 139244986 |
| Molecular Formula | C11H15BBr2N2O2 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | CC1(C)OB(c2c(Br)cnc(N)c2Br)OC1(C)C |
| InChI | InChI=1S/C11H15BBr2N2O2/c1-10(2)11(3,4)18-12(17-10)7-6(13)5-16-9(15)8(7)14/h5H,1-4H3,(H2,15,16) |
| InChIKey | OPLUSAQTMYRVRH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|