C16H19BBr2N2O3 — CID 139244987
N-[3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pent-4-ynamide (PubChem CID 139244987) has the molecular formula C16H19BBr2N2O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is N-[3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pent-4-ynamide.
| Compound Name | N-[3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pent-4-ynamide |
|---|---|
| PubChem CID | 139244987 |
| Molecular Formula | C16H19BBr2N2O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | N-[3,5-dibromo-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pent-4-ynamide |
| SMILES | C#CCCC(=O)Nc1ncc(Br)c(B2OC(C)(C)C(C)(C)O2)c1Br |
| InChI | InChI=1S/C16H19BBr2N2O3/c1-6-7-8-11(22)21-14-13(19)12(10(18)9-20-14)17-23-15(2,3)16(4,5)24-17/h1,9H,7-8H2,2-5H3,(H,20,21,22) |
| InChIKey | OZTKVOKJNANRMW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|