C7H12N2O2S — CID 139245347
1-acetyl-4-sulfanylpyrrolidine-2-carboxamide (PubChem CID 139245347) has the molecular formula C7H12N2O2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 1-acetyl-4-sulfanylpyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-4-sulfanylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139245347 |
| Molecular Formula | C7H12N2O2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 1-acetyl-4-sulfanylpyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CC(S)CC1C(N)=O |
| InChI | InChI=1S/C7H12N2O2S/c1-4(10)9-3-5(12)2-6(9)7(8)11/h5-6,12H,2-3H2,1H3,(H2,8,11) |
| InChIKey | OWYBIUKCGXEUSV-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|