C38H28FNO6 — CID 139246068
dimethyl (Z)-2-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(4-methoxycarbonylfluoren-9-id-9-yl)but-2-enedioate (PubChem CID 139246068) has the molecular formula C38H28FNO6 and a molecular weight of 613.64 g/mol. Its IUPAC name is dimethyl (Z)-2-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(4-methoxycarbonylfluoren-9-id-9-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(4-methoxycarbonylfluoren-9-id-9-yl)but-2-enedioate |
|---|---|
| PubChem CID | 139246068 |
| Molecular Formula | C38H28FNO6 |
| Molecular Weight | 613.64 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | dimethyl (Z)-2-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(4-methoxycarbonylfluoren-9-id-9-yl)but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)[n+]1ccc(/C=C/c2cccc(F)c2)c2ccccc21)[c-]1c2ccccc2c2c(C(=O)OC)cccc21 |
| InChI | InChI=1S/C38H28FNO6/c1-44-36(41)30-16-9-15-29-32(30)27-13-4-5-14-28(27)33(29)34(37(42)45-2)35(38(43)46-3)40-21-20-24(26-12-6-7-17-31(26)40)19-18-23-10-8-11-25(39)22-23/h4-22H,1-3H3/b19-18+,35-34- |
| InChIKey | GFIHMQJYOOAGCF-IOLBKAQXSA-N |
| XLogP | 6.96 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.64 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|