C36H24Cl2FNO4 — CID 139246066
dimethyl (Z)-2-(2,7-dichlorofluoren-9-id-9-yl)-3-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]but-2-enedioate (PubChem CID 139246066) has the molecular formula C36H24Cl2FNO4 and a molecular weight of 624.50 g/mol. Its IUPAC name is dimethyl (Z)-2-(2,7-dichlorofluoren-9-id-9-yl)-3-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(2,7-dichlorofluoren-9-id-9-yl)-3-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]but-2-enedioate |
|---|---|
| PubChem CID | 139246066 |
| Molecular Formula | C36H24Cl2FNO4 |
| Molecular Weight | 624.50 g/mol |
| Exact Mass | 623.11 |
| IUPAC Name | dimethyl (Z)-2-(2,7-dichlorofluoren-9-id-9-yl)-3-[4-[(E)-2-(3-fluorophenyl)ethenyl]quinolin-1-ium-1-yl]but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)[n+]1ccc(/C=C/c2cccc(F)c2)c2ccccc21)[c-]1c2cc(Cl)ccc2c2ccc(Cl)cc21 |
| InChI | InChI=1S/C36H24Cl2FNO4/c1-43-35(41)33(32-29-19-23(37)12-14-27(29)28-15-13-24(38)20-30(28)32)34(36(42)44-2)40-17-16-22(26-8-3-4-9-31(26)40)11-10-21-6-5-7-25(39)18-21/h3-20H,1-2H3/b11-10+,34-33- |
| InChIKey | ZZSRYYYWSGPKMG-UBRQZCIQSA-N |
| XLogP | 8.48 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.50 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|