C36H24Cl3NO4 — CID 139246074
dimethyl (Z)-2-[4-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(2,7-dichlorofluoren-9-id-9-yl)but-2-enedioate (PubChem CID 139246074) has the molecular formula C36H24Cl3NO4 and a molecular weight of 640.95 g/mol. Its IUPAC name is dimethyl (Z)-2-[4-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(2,7-dichlorofluoren-9-id-9-yl)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-[4-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(2,7-dichlorofluoren-9-id-9-yl)but-2-enedioate |
|---|---|
| PubChem CID | 139246074 |
| Molecular Formula | C36H24Cl3NO4 |
| Molecular Weight | 640.95 g/mol |
| Exact Mass | 639.08 |
| IUPAC Name | dimethyl (Z)-2-[4-[(E)-2-(2-chlorophenyl)ethenyl]quinolin-1-ium-1-yl]-3-(2,7-dichlorofluoren-9-id-9-yl)but-2-enedioate |
| SMILES | COC(=O)/C(=C(/C(=O)OC)[n+]1ccc(/C=C/c2ccccc2Cl)c2ccccc21)[c-]1c2cc(Cl)ccc2c2ccc(Cl)cc21 |
| InChI | InChI=1S/C36H24Cl3NO4/c1-43-35(41)33(32-28-19-23(37)13-15-26(28)27-16-14-24(38)20-29(27)32)34(36(42)44-2)40-18-17-21(25-8-4-6-10-31(25)40)11-12-22-7-3-5-9-30(22)39/h3-20H,1-2H3/b12-11+,34-33- |
| InChIKey | ISVHUHJZMHONKI-BCUDEBDISA-N |
| XLogP | 9.00 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.95 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|